C45H41N2OPtS- — CID 164743352
2-[4-[3-benzyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzothiazol-2-yl]-4,6-ditert-butylphenol;platinum (PubChem CID 164743352) has the molecular formula C45H41N2OPtS- and a molecular weight of 852.98 g/mol. Its IUPAC name is 2-[4-[3-benzyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzothiazol-2-yl]-4,6-ditert-butylphenol;platinum.
| Compound Name | 2-[4-[3-benzyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzothiazol-2-yl]-4,6-ditert-butylphenol;platinum |
|---|---|
| PubChem CID | 164743352 |
| Molecular Formula | C45H41N2OPtS- |
| Molecular Weight | 852.98 g/mol |
| Exact Mass | 852.26 |
| IUPAC Name | 2-[4-[3-benzyl-5-(4-phenyl-2-pyridinyl)benzene-6-id-1-yl]-1,3-benzothiazol-2-yl]-4,6-ditert-butylphenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2nc3c(-c4[c-]c(-c5cc(-c6ccccc6)ccn5)cc(Cc5ccccc5)c4)cccc3s2)c(O)c(C(C)(C)C)c1.[Pt] |
| InChI | InChI=1S/C45H41N2OS.Pt/c1-44(2,3)35-27-37(42(48)38(28-35)45(4,5)6)43-47-41-36(18-13-19-40(41)49-43)33-23-30(22-29-14-9-7-10-15-29)24-34(25-33)39-26-32(20-21-46-39)31-16-11-8-12-17-31;/h7-21,23-24,26-28,48H,22H2,1-6H3;/q-1; |
| InChIKey | NFOLVIJXPXFYMZ-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 852.98 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|