C53H54N3OPt- — CID 164743211
2-[4-(3-benzylphenyl)-6-[3-tert-butyl-5-(3,5-ditert-butyl-N-pyridin-2-ylanilino)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 164743211) has the molecular formula C53H54N3OPt- and a molecular weight of 944.11 g/mol. Its IUPAC name is 2-[4-(3-benzylphenyl)-6-[3-tert-butyl-5-(3,5-ditert-butyl-N-pyridin-2-ylanilino)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[4-(3-benzylphenyl)-6-[3-tert-butyl-5-(3,5-ditert-butyl-N-pyridin-2-ylanilino)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164743211 |
| Molecular Formula | C53H54N3OPt- |
| Molecular Weight | 944.11 g/mol |
| Exact Mass | 943.39 |
| IUPAC Name | 2-[4-(3-benzylphenyl)-6-[3-tert-butyl-5-(3,5-ditert-butyl-N-pyridin-2-ylanilino)benzene-6-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cccc(Cc4ccccc4)c3)cc(-c3ccccc3O)n2)[c-]c(N(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccccn2)c1.[Pt] |
| InChI | InChI=1S/C53H54N3O.Pt/c1-51(2,3)41-28-40(29-44(33-41)56(50-24-15-16-25-54-50)45-34-42(52(4,5)6)32-43(35-45)53(7,8)9)47-30-39(31-48(55-47)46-22-13-14-23-49(46)57)38-21-17-20-37(27-38)26-36-18-11-10-12-19-36;/h10-25,27-28,30-35,57H,26H2,1-9H3;/q-1; |
| InChIKey | OPYVSQMWIOVJAN-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.11 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|