C50H45N3O — CID 136600920
2-[6-[3-[anthracen-9-yl(pyridin-2-yl)amino]phenyl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol (PubChem CID 136600920) has the molecular formula C50H45N3O and a molecular weight of 703.93 g/mol. Its IUPAC name is 2-[6-[3-[anthracen-9-yl(pyridin-2-yl)amino]phenyl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol.
| Compound Name | 2-[6-[3-[anthracen-9-yl(pyridin-2-yl)amino]phenyl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 136600920 |
| Molecular Formula | C50H45N3O |
| Molecular Weight | 703.93 g/mol |
| Exact Mass | 703.36 |
| IUPAC Name | 2-[6-[3-[anthracen-9-yl(pyridin-2-yl)amino]phenyl]-4-(3,5-ditert-butylphenyl)-2-pyridinyl]phenol |
| SMILES | CC(C)(C)c1cc(-c2cc(-c3cccc(N(c4ccccn4)c4c5ccccc5cc5ccccc45)c3)nc(-c3ccccc3O)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C50H45N3O/c1-49(2,3)38-27-36(28-39(32-38)50(4,5)6)37-30-44(52-45(31-37)43-22-11-12-23-46(43)54)35-18-15-19-40(29-35)53(47-24-13-14-25-51-47)48-41-20-9-7-16-33(41)26-34-17-8-10-21-42(34)48/h7-32,54H,1-6H3 |
| InChIKey | SVJOEDHHHCSHFT-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.93 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|