C25H23N3OS — CID 153280198
2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylphenyl)pyrimidin-2-yl]phenol (PubChem CID 153280198) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylphenyl)pyrimidin-2-yl]phenol.
| Compound Name | 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylphenyl)pyrimidin-2-yl]phenol |
|---|---|
| PubChem CID | 153280198 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 2-tert-butyl-6-[4-(3-pyridin-2-ylsulfanylphenyl)pyrimidin-2-yl]phenol |
| SMILES | CC(C)(C)c1cccc(-c2nccc(-c3cccc(Sc4ccccn4)c3)n2)c1O |
| InChI | InChI=1S/C25H23N3OS/c1-25(2,3)20-11-7-10-19(23(20)29)24-27-15-13-21(28-24)17-8-6-9-18(16-17)30-22-12-4-5-14-26-22/h4-16,29H,1-3H3 |
| InChIKey | NGKVBHNQHDSHFZ-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |