C26H14N2OPtS — CID 168721177
CID 168721177 (PubChem CID 168721177) has the molecular formula C26H14N2OPtS and a molecular weight of 597.56 g/mol.
| Compound Name | CID 168721177 |
|---|---|
| PubChem CID | 168721177 |
| Molecular Formula | C26H14N2OPtS |
| Molecular Weight | 597.56 g/mol |
| Exact Mass | 597.05 |
| IUPAC Name | — |
| SMILES | [Pt+2].[c-]1ccccc1-c1cccc(Oc2[c-]c3c4ncccc4sc3c3ccccc23)n1 |
| InChI | InChI=1S/C26H14N2OS.Pt/c1-2-8-17(9-3-1)21-12-6-14-24(28-21)29-22-16-20-25-23(13-7-15-27-25)30-26(20)19-11-5-4-10-18(19)22;/h1-8,10-15H;/q-2;+2 |
| InChIKey | VPWHEJOPVJBTNI-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.56 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|