C28H17N2O2Pt- — CID 166562222
2-[(6-phenyl-2-pyridinyl)oxy]phenanthro[10,9-b]pyridin-12-ol;platinum (PubChem CID 166562222) has the molecular formula C28H17N2O2Pt- and a molecular weight of 608.53 g/mol. Its IUPAC name is 2-[(6-phenyl-2-pyridinyl)oxy]phenanthro[10,9-b]pyridin-12-ol;platinum.
| Compound Name | 2-[(6-phenyl-2-pyridinyl)oxy]phenanthro[10,9-b]pyridin-12-ol;platinum |
|---|---|
| PubChem CID | 166562222 |
| Molecular Formula | C28H17N2O2Pt- |
| Molecular Weight | 608.53 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | 2-[(6-phenyl-2-pyridinyl)oxy]phenanthro[10,9-b]pyridin-12-ol;platinum |
| SMILES | Oc1cccc2c3ccccc3c3ccc(Oc4cccc(-c5[c-]cccc5)n4)nc3c12.[Pt] |
| InChI | InChI=1S/C28H17N2O2.Pt/c31-24-14-6-12-21-19-10-4-5-11-20(19)22-16-17-26(30-28(22)27(21)24)32-25-15-7-13-23(29-25)18-8-2-1-3-9-18;/h1-8,10-17,31H;/q-1; |
| InChIKey | DAYJZTCRKTZKCM-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.53 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|