C33H20N2OPtS — CID 169025695
6-[3-methyl-5-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-6-id-1-yl]-8-thia-5-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene;platinum(2+) (PubChem CID 169025695) has the molecular formula C33H20N2OPtS and a molecular weight of 687.68 g/mol. Its IUPAC name is 6-[3-methyl-5-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-6-id-1-yl]-8-thia-5-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene;platinum(2+).
| Compound Name | 6-[3-methyl-5-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-6-id-1-yl]-8-thia-5-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene;platinum(2+) |
|---|---|
| PubChem CID | 169025695 |
| Molecular Formula | C33H20N2OPtS |
| Molecular Weight | 687.68 g/mol |
| Exact Mass | 687.09 |
| IUPAC Name | 6-[3-methyl-5-(3-pyridin-2-ylbenzene-2-id-1-yl)oxybenzene-6-id-1-yl]-8-thia-5-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9,11,13(17),14-octaene;platinum(2+) |
| SMILES | Cc1cc(Oc2[c-]c(-c3ccccn3)ccc2)[c-]c(-c2nccc3c2Sc2cccc4cccc-3c24)c1.[Pt+2] |
| InChI | InChI=1S/C33H20N2OS.Pt/c1-21-17-24(20-26(18-21)36-25-10-4-9-23(19-25)29-12-2-3-15-34-29)32-33-28(14-16-35-32)27-11-5-7-22-8-6-13-30(37-33)31(22)27;/h2-18H,1H3;/q-2;+2 |
| InChIKey | RFGQAODYAXDFNC-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.68 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|