C43H30N2OPtS — CID 162461805
2-[9-[3-[3-(2,6-dimethylphenyl)-5-pyridin-2-ylbenzene-6-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) (PubChem CID 162461805) has the molecular formula C43H30N2OPtS and a molecular weight of 817.87 g/mol. Its IUPAC name is 2-[9-[3-[3-(2,6-dimethylphenyl)-5-pyridin-2-ylbenzene-6-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+).
| Compound Name | 2-[9-[3-[3-(2,6-dimethylphenyl)-5-pyridin-2-ylbenzene-6-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 162461805 |
| Molecular Formula | C43H30N2OPtS |
| Molecular Weight | 817.87 g/mol |
| Exact Mass | 817.17 |
| IUPAC Name | 2-[9-[3-[3-(2,6-dimethylphenyl)-5-pyridin-2-ylbenzene-6-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) |
| SMILES | Cc1cccc(C)c1-c1cc(Oc2[c-]c(C3(c4ccccn4)c4ccccc4Sc4ccccc43)ccc2)[c-]c(-c2ccccn2)c1.[Pt+2] |
| InChI | InChI=1S/C43H30N2OS.Pt/c1-29-13-11-14-30(2)42(29)32-25-31(38-19-7-9-23-44-38)26-35(27-32)46-34-16-12-15-33(28-34)43(41-22-8-10-24-45-41)36-17-3-5-20-39(36)47-40-21-6-4-18-37(40)43;/h3-25,27H,1-2H3;/q-2;+2 |
| InChIKey | LYOBDNOGXDJVGN-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.87 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|