C38H24N4OPtS — CID 162461716
2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) (PubChem CID 162461716) has the molecular formula C38H24N4OPtS and a molecular weight of 779.78 g/mol. Its IUPAC name is 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+).
| Compound Name | 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 162461716 |
| Molecular Formula | C38H24N4OPtS |
| Molecular Weight | 779.78 g/mol |
| Exact Mass | 779.13 |
| IUPAC Name | 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]thioxanthen-9-yl]pyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c(C3(c4ccccn4)c4ccccc4Sc4ccccc43)ccc2)cccc1-n1ncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C38H24N4OS.Pt/c1-2-12-27(13-3-1)34-26-40-42(41-34)29-15-11-17-31(25-29)43-30-16-10-14-28(24-30)38(37-22-8-9-23-39-37)32-18-4-6-20-35(32)44-36-21-7-5-19-33(36)38;/h1-23,26H;/q-2;+2 |
| InChIKey | QEWKTVNENQIILE-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.78 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|