C37H22N2OPtS — CID 162461860
platinum(2+);3-[2-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]oxy-3H-thiophen-3-id-4-yl]isoquinoline (PubChem CID 162461860) has the molecular formula C37H22N2OPtS and a molecular weight of 737.74 g/mol. Its IUPAC name is platinum(2+);3-[2-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]oxy-3H-thiophen-3-id-4-yl]isoquinoline.
| Compound Name | platinum(2+);3-[2-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]oxy-3H-thiophen-3-id-4-yl]isoquinoline |
|---|---|
| PubChem CID | 162461860 |
| Molecular Formula | C37H22N2OPtS |
| Molecular Weight | 737.74 g/mol |
| Exact Mass | 737.11 |
| IUPAC Name | platinum(2+);3-[2-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]oxy-3H-thiophen-3-id-4-yl]isoquinoline |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c(-c3cc4ccccc4cn3)cs2)cccc1C1(c2ccccn2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H22N2OS.Pt/c1-2-11-26-23-39-34(20-25(26)10-1)27-21-36(41-24-27)40-29-13-9-12-28(22-29)37(35-18-7-8-19-38-35)32-16-5-3-14-30(32)31-15-4-6-17-33(31)37;/h1-20,23-24H;/q-2;+2 |
| InChIKey | QKFDEPIVNCIEJT-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.74 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|