C74H48N2Pt — CID 167327911
2-[9-[3-[2,2-bis(3-phenylphenyl)-1-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]ethenyl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) (PubChem CID 167327911) has the molecular formula C74H48N2Pt and a molecular weight of 1160.29 g/mol. Its IUPAC name is 2-[9-[3-[2,2-bis(3-phenylphenyl)-1-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]ethenyl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+).
| Compound Name | 2-[9-[3-[2,2-bis(3-phenylphenyl)-1-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]ethenyl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 167327911 |
| Molecular Formula | C74H48N2Pt |
| Molecular Weight | 1160.29 g/mol |
| Exact Mass | 1159.35 |
| IUPAC Name | 2-[9-[3-[2,2-bis(3-phenylphenyl)-1-[3-(9-pyridin-2-ylfluoren-9-yl)benzene-2-id-1-yl]ethenyl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(C(=C(c2cccc(-c3ccccc3)c2)c2cccc(-c3ccccc3)c2)c2[c-]c(C3(c4ccccn4)c4ccccc4-c4ccccc43)ccc2)cccc1C1(c2ccccn2)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C74H48N2.Pt/c1-3-23-51(24-4-1)53-27-19-29-55(47-53)71(56-30-20-28-54(48-56)52-25-5-2-6-26-52)72(57-31-21-33-59(49-57)73(69-43-15-17-45-75-69)65-39-11-7-35-61(65)62-36-8-12-40-66(62)73)58-32-22-34-60(50-58)74(70-44-16-18-46-76-70)67-41-13-9-37-63(67)64-38-10-14-42-68(64)74;/h1-48H;/q-2;+2 |
| InChIKey | WQMQEAAPUFGRMT-UHFFFAOYSA-N |
| XLogP | 17.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1160.29 |
| LogP ≤ 5 | 17.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|