C61H42N3Pt-3 — CID 176592361
2-[9-[3-[9-[3-[9-(3,4-dimethyl-2H-imidazol-2-id-1-yl)fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum (PubChem CID 176592361) has the molecular formula C61H42N3Pt-3 and a molecular weight of 1012.11 g/mol. Its IUPAC name is 2-[9-[3-[9-[3-[9-(3,4-dimethyl-2H-imidazol-2-id-1-yl)fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum.
| Compound Name | 2-[9-[3-[9-[3-[9-(3,4-dimethyl-2H-imidazol-2-id-1-yl)fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum |
|---|---|
| PubChem CID | 176592361 |
| Molecular Formula | C61H42N3Pt-3 |
| Molecular Weight | 1012.11 g/mol |
| Exact Mass | 1011.30 |
| IUPAC Name | 2-[9-[3-[9-[3-[9-(3,4-dimethyl-2H-imidazol-2-id-1-yl)fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]benzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum |
| SMILES | CC1=CN(C2(c3[c-]c(C4(c5[c-]c(C6(c7ccccn7)c7ccccc7-c7ccccc76)ccc5)c5ccccc5-c5ccccc54)ccc3)c3ccccc3-c3ccccc32)[CH-]N1C.[Pt] |
| InChI | InChI=1S/C61H42N3.Pt/c1-41-39-64(40-63(41)2)61(56-33-13-7-27-50(56)51-28-8-14-34-57(51)61)45-22-18-20-43(38-45)59(52-29-9-3-23-46(52)47-24-4-10-30-53(47)59)42-19-17-21-44(37-42)60(58-35-15-16-36-62-58)54-31-11-5-25-48(54)49-26-6-12-32-55(49)60;/h3-36,39-40H,1-2H3;/q-3; |
| InChIKey | DXQGDFWVZZAYAR-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.11 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|