C38H24N4OPt — CID 162461919
2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) (PubChem CID 162461919) has the molecular formula C38H24N4OPt and a molecular weight of 747.72 g/mol. Its IUPAC name is 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+).
| Compound Name | 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 162461919 |
| Molecular Formula | C38H24N4OPt |
| Molecular Weight | 747.72 g/mol |
| Exact Mass | 747.16 |
| IUPAC Name | 2-[9-[3-[3-(4-phenyltriazol-2-yl)benzene-2-id-1-yl]oxybenzene-2-id-1-yl]fluoren-9-yl]pyridine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2[c-]c(C3(c4ccccn4)c4ccccc4-c4ccccc43)ccc2)cccc1-n1ncc(-c2ccccc2)n1 |
| InChI | InChI=1S/C38H24N4O.Pt/c1-2-12-27(13-3-1)36-26-40-42(41-36)29-15-11-17-31(25-29)43-30-16-10-14-28(24-30)38(37-22-8-9-23-39-37)34-20-6-4-18-32(34)33-19-5-7-21-35(33)38;/h1-23,26H;/q-2;+2 |
| InChIKey | IFIQMNVJJDBNJM-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.72 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|