C28H17N3O2Pt — CID 153433511
9-phenyl-3,6-dipyridin-2-yloxy-4,5-dihydrocarbazole-4,5-diide;platinum(2+) (PubChem CID 153433511) has the molecular formula C28H17N3O2Pt and a molecular weight of 622.54 g/mol. Its IUPAC name is 9-phenyl-3,6-dipyridin-2-yloxy-4,5-dihydrocarbazole-4,5-diide;platinum(2+).
| Compound Name | 9-phenyl-3,6-dipyridin-2-yloxy-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
|---|---|
| PubChem CID | 153433511 |
| Molecular Formula | C28H17N3O2Pt |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | 9-phenyl-3,6-dipyridin-2-yloxy-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(Oc2ccccn2)ccc2c1c1[c-]c(Oc3ccccn3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C28H17N3O2.Pt/c1-2-8-20(9-3-1)31-25-14-12-21(32-27-10-4-6-16-29-27)18-23(25)24-19-22(13-15-26(24)31)33-28-11-5-7-17-30-28;/h1-17H;/q-2;+2 |
| InChIKey | XNGWANYQAJFUSD-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|