C40H26FN5Pt — CID 153433370
9-(4-fluorophenyl)-3-N,6-N-diphenyl-3-N,6-N-dipyridin-2-yl-4,5-dihydrocarbazole-4,5-diide-3,6-diamine;platinum(2+) (PubChem CID 153433370) has the molecular formula C40H26FN5Pt and a molecular weight of 790.76 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-3-N,6-N-diphenyl-3-N,6-N-dipyridin-2-yl-4,5-dihydrocarbazole-4,5-diide-3,6-diamine;platinum(2+).
| Compound Name | 9-(4-fluorophenyl)-3-N,6-N-diphenyl-3-N,6-N-dipyridin-2-yl-4,5-dihydrocarbazole-4,5-diide-3,6-diamine;platinum(2+) |
|---|---|
| PubChem CID | 153433370 |
| Molecular Formula | C40H26FN5Pt |
| Molecular Weight | 790.76 g/mol |
| Exact Mass | 790.18 |
| IUPAC Name | 9-(4-fluorophenyl)-3-N,6-N-diphenyl-3-N,6-N-dipyridin-2-yl-4,5-dihydrocarbazole-4,5-diide-3,6-diamine;platinum(2+) |
| SMILES | Fc1ccc(-n2c3ccc(N(c4ccccc4)c4ccccn4)[c-]c3c3[c-]c(N(c4ccccc4)c4ccccn4)ccc32)cc1.[Pt+2] |
| InChI | InChI=1S/C40H26FN5.Pt/c41-29-17-19-32(20-18-29)46-37-23-21-33(44(30-11-3-1-4-12-30)39-15-7-9-25-42-39)27-35(37)36-28-34(22-24-38(36)46)45(31-13-5-2-6-14-31)40-16-8-10-26-43-40;/h1-26H;/q-2;+2 |
| InChIKey | BNQCMJYEKLHAAU-UHFFFAOYSA-N |
| XLogP | 10.25 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.76 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|