C41H29N3OPt — CID 171752210
2-[3-(N-phenylanilino)-5-[3-(N-pyridin-2-ylanilino)benzene-2-id-1-yl]benzene-6-id-1-yl]phenol;platinum(2+) (PubChem CID 171752210) has the molecular formula C41H29N3OPt and a molecular weight of 774.78 g/mol. Its IUPAC name is 2-[3-(N-phenylanilino)-5-[3-(N-pyridin-2-ylanilino)benzene-2-id-1-yl]benzene-6-id-1-yl]phenol;platinum(2+).
| Compound Name | 2-[3-(N-phenylanilino)-5-[3-(N-pyridin-2-ylanilino)benzene-2-id-1-yl]benzene-6-id-1-yl]phenol;platinum(2+) |
|---|---|
| PubChem CID | 171752210 |
| Molecular Formula | C41H29N3OPt |
| Molecular Weight | 774.78 g/mol |
| Exact Mass | 774.20 |
| IUPAC Name | 2-[3-(N-phenylanilino)-5-[3-(N-pyridin-2-ylanilino)benzene-2-id-1-yl]benzene-6-id-1-yl]phenol;platinum(2+) |
| SMILES | Oc1ccccc1-c1[c-]c(-c2[c-]c(N(c3ccccc3)c3ccccn3)ccc2)cc(N(c2ccccc2)c2ccccc2)c1.[Pt+2] |
| InChI | InChI=1S/C41H29N3O.Pt/c45-40-24-11-10-23-39(40)33-27-32(29-38(30-33)43(34-16-4-1-5-17-34)35-18-6-2-7-19-35)31-15-14-22-37(28-31)44(36-20-8-3-9-21-36)41-25-12-13-26-42-41;/h1-26,29-30,45H;/q-2;+2 |
| InChIKey | AEMWRJOOMKDJBF-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.78 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|