C37H30N3OPt- — CID 164742061
2-[6-[3-(N-[3-(2-phenylpropan-2-yl)-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum (PubChem CID 164742061) has the molecular formula C37H30N3OPt- and a molecular weight of 727.75 g/mol. Its IUPAC name is 2-[6-[3-(N-[3-(2-phenylpropan-2-yl)-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum.
| Compound Name | 2-[6-[3-(N-[3-(2-phenylpropan-2-yl)-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
|---|---|
| PubChem CID | 164742061 |
| Molecular Formula | C37H30N3OPt- |
| Molecular Weight | 727.75 g/mol |
| Exact Mass | 727.20 |
| IUPAC Name | 2-[6-[3-(N-[3-(2-phenylpropan-2-yl)-2-pyridinyl]anilino)benzene-2-id-1-yl]-2-pyridinyl]phenol;platinum |
| SMILES | CC(C)(c1ccccc1)c1cccnc1N(c1[c-]c(-c2cccc(-c3ccccc3O)n2)ccc1)c1ccccc1.[Pt] |
| InChI | InChI=1S/C37H30N3O.Pt/c1-37(2,28-15-5-3-6-16-28)32-21-13-25-38-36(32)40(29-17-7-4-8-18-29)30-19-11-14-27(26-30)33-22-12-23-34(39-33)31-20-9-10-24-35(31)41;/h3-25,41H,1-2H3;/q-1; |
| InChIKey | ZIDUKNCIJATOPI-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.75 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|