C27H19N4OPt- — CID 153280501
platinum;2-[4-[6-(N-pyridin-2-ylanilino)-2-pyridinyl]-3H-pyridin-3-id-2-yl]phenol (PubChem CID 153280501) has the molecular formula C27H19N4OPt- and a molecular weight of 610.55 g/mol. Its IUPAC name is platinum;2-[4-[6-(N-pyridin-2-ylanilino)-2-pyridinyl]-3H-pyridin-3-id-2-yl]phenol.
| Compound Name | platinum;2-[4-[6-(N-pyridin-2-ylanilino)-2-pyridinyl]-3H-pyridin-3-id-2-yl]phenol |
|---|---|
| PubChem CID | 153280501 |
| Molecular Formula | C27H19N4OPt- |
| Molecular Weight | 610.55 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | platinum;2-[4-[6-(N-pyridin-2-ylanilino)-2-pyridinyl]-3H-pyridin-3-id-2-yl]phenol |
| SMILES | Oc1ccccc1-c1[c-]c(-c2cccc(N(c3ccccc3)c3ccccn3)n2)ccn1.[Pt] |
| InChI | InChI=1S/C27H19N4O.Pt/c32-25-13-5-4-11-22(25)24-19-20(16-18-28-24)23-12-8-15-27(30-23)31(21-9-2-1-3-10-21)26-14-6-7-17-29-26;/h1-18,32H;/q-1; |
| InChIKey | UBGXDYKAMOLPNY-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.55 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|