C44H33N3OPt — CID 171752200
9,9-dimethyl-6-[3-(N-[4-(N-phenylanilino)-2-pyridinyl]anilino)benzene-2-id-1-yl]-5H-fluoren-5-id-4-ol;platinum(2+) (PubChem CID 171752200) has the molecular formula C44H33N3OPt and a molecular weight of 814.85 g/mol. Its IUPAC name is 9,9-dimethyl-6-[3-(N-[4-(N-phenylanilino)-2-pyridinyl]anilino)benzene-2-id-1-yl]-5H-fluoren-5-id-4-ol;platinum(2+).
| Compound Name | 9,9-dimethyl-6-[3-(N-[4-(N-phenylanilino)-2-pyridinyl]anilino)benzene-2-id-1-yl]-5H-fluoren-5-id-4-ol;platinum(2+) |
|---|---|
| PubChem CID | 171752200 |
| Molecular Formula | C44H33N3OPt |
| Molecular Weight | 814.85 g/mol |
| Exact Mass | 814.23 |
| IUPAC Name | 9,9-dimethyl-6-[3-(N-[4-(N-phenylanilino)-2-pyridinyl]anilino)benzene-2-id-1-yl]-5H-fluoren-5-id-4-ol;platinum(2+) |
| SMILES | CC1(C)c2ccc(-c3[c-]c(N(c4ccccc4)c4cc(N(c5ccccc5)c5ccccc5)ccn4)ccc3)[c-]c2-c2c(O)cccc21.[Pt+2] |
| InChI | InChI=1S/C44H33N3O.Pt/c1-44(2)39-25-24-32(29-38(39)43-40(44)22-13-23-41(43)48)31-14-12-21-36(28-31)47(35-19-10-5-11-20-35)42-30-37(26-27-45-42)46(33-15-6-3-7-16-33)34-17-8-4-9-18-34;/h3-27,30,48H,1-2H3;/q-2;+2 |
| InChIKey | BULBIOOAQDHXQV-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 814.85 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|