C52H42N4Pt — CID 58831160
CID 58831160 (PubChem CID 58831160) has the molecular formula C52H42N4Pt and a molecular weight of 918.01 g/mol.
| Compound Name | CID 58831160 |
|---|---|
| PubChem CID | 58831160 |
| Molecular Formula | C52H42N4Pt |
| Molecular Weight | 918.01 g/mol |
| Exact Mass | 917.31 |
| IUPAC Name | — |
| SMILES | CC1(C)c2[c-]c(ccc2)-c2cc(N(c3ccccc3)c3ccccc3)cc(n2)C(C)(C)c2cc(N(c3ccccc3)c3ccccc3)cc(n2)-c2[c-]c1ccc2.[Pt+2] |
| InChI | InChI=1S/C52H42N4.Pt/c1-51(2)39-21-17-19-37(31-39)47-33-45(55(41-23-9-5-10-24-41)42-25-11-6-12-26-42)35-49(53-47)52(3,4)50-36-46(34-48(54-50)38-20-18-22-40(51)32-38)56(43-27-13-7-14-28-43)44-29-15-8-16-30-44;/h5-30,33-36H,1-4H3;/q-2;+2 |
| InChIKey | SLFGTJKTYTZNCA-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 918.01 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|