C44H44N3OPt- — CID 164731372
2-[3-(3,5-ditert-butyl-N-[6-[4-(2,6-dimethylphenyl)-2-pyridinyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]phenol;platinum (PubChem CID 164731372) has the molecular formula C44H44N3OPt- and a molecular weight of 825.93 g/mol. Its IUPAC name is 2-[3-(3,5-ditert-butyl-N-[6-[4-(2,6-dimethylphenyl)-2-pyridinyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]phenol;platinum.
| Compound Name | 2-[3-(3,5-ditert-butyl-N-[6-[4-(2,6-dimethylphenyl)-2-pyridinyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]phenol;platinum |
|---|---|
| PubChem CID | 164731372 |
| Molecular Formula | C44H44N3OPt- |
| Molecular Weight | 825.93 g/mol |
| Exact Mass | 825.31 |
| IUPAC Name | 2-[3-(3,5-ditert-butyl-N-[6-[4-(2,6-dimethylphenyl)-2-pyridinyl]-2-pyridinyl]anilino)benzene-2-id-1-yl]phenol;platinum |
| SMILES | Cc1cccc(C)c1-c1ccnc(-c2cccc(N(c3[c-]c(-c4ccccc4O)ccc3)c3cc(C(C)(C)C)cc(C(C)(C)C)c3)n2)c1.[Pt] |
| InChI | InChI=1S/C44H44N3O.Pt/c1-29-14-11-15-30(2)42(29)32-22-23-45-39(25-32)38-19-13-21-41(46-38)47(35-17-12-16-31(24-35)37-18-9-10-20-40(37)48)36-27-33(43(3,4)5)26-34(28-36)44(6,7)8;/h9-23,25-28,48H,1-8H3;/q-1; |
| InChIKey | ZRMRAQSYKABOER-UHFFFAOYSA-N |
| XLogP | 11.66 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.93 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|