C32H22F2N4 — CID 102388194
4-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-4-yl]-N,N-diphenylaniline (PubChem CID 102388194) has the molecular formula C32H22F2N4 and a molecular weight of 500.55 g/mol. Its IUPAC name is 4-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-4-yl]-N,N-diphenylaniline.
| Compound Name | 4-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-4-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102388194 |
| Molecular Formula | C32H22F2N4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | 4-[3,5-bis(4-fluorophenyl)-1,2,4-triazol-4-yl]-N,N-diphenylaniline |
| SMILES | Fc1ccc(-c2nnc(-c3ccc(F)cc3)n2-c2ccc(N(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C32H22F2N4/c33-25-15-11-23(12-16-25)31-35-36-32(24-13-17-26(34)18-14-24)38(31)30-21-19-29(20-22-30)37(27-7-3-1-4-8-27)28-9-5-2-6-10-28/h1-22H |
| InChIKey | YVJITGGZNIRNIU-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |