C74H54N6 — CID 102173771
4-[4-[4,5-bis[4-[4-(N-phenylanilino)phenyl]phenyl]-1,2,4-triazol-3-yl]phenyl]-N,N-diphenylaniline (PubChem CID 102173771) has the molecular formula C74H54N6 and a molecular weight of 1027.29 g/mol. Its IUPAC name is 4-[4-[4,5-bis[4-[4-(N-phenylanilino)phenyl]phenyl]-1,2,4-triazol-3-yl]phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[4-[4,5-bis[4-[4-(N-phenylanilino)phenyl]phenyl]-1,2,4-triazol-3-yl]phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 102173771 |
| Molecular Formula | C74H54N6 |
| Molecular Weight | 1027.29 g/mol |
| Exact Mass | 1026.44 |
| IUPAC Name | 4-[4-[4,5-bis[4-[4-(N-phenylanilino)phenyl]phenyl]-1,2,4-triazol-3-yl]phenyl]-N,N-diphenylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc(-c3ccc(-c4nnc(-c5ccc(-c6ccc(N(c7ccccc7)c7ccccc7)cc6)cc5)n4-c4ccc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C74H54N6/c1-7-19-63(20-8-1)77(64-21-9-2-10-22-64)69-47-39-57(40-48-69)55-31-35-61(36-32-55)73-75-76-74(62-37-33-56(34-38-62)58-41-49-70(50-42-58)78(65-23-11-3-12-24-65)66-25-13-4-14-26-66)80(73)72-53-45-60(46-54-72)59-43-51-71(52-44-59)79(67-27-15-5-16-28-67)68-29-17-6-18-30-68/h1-54H |
| InChIKey | YYIHUKDQDQQSEC-UHFFFAOYSA-N |
| XLogP | 20.01 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1027.29 |
| LogP ≤ 5 | 20.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |