C42H27N5Pt — CID 163770103
acetylene;N-phenyl-9-pyridin-2-yl-N-(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)-1H-carbazol-1-id-2-amine;platinum(2+) (PubChem CID 163770103) has the molecular formula C42H27N5Pt and a molecular weight of 796.79 g/mol. Its IUPAC name is acetylene;N-phenyl-9-pyridin-2-yl-N-(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)-1H-carbazol-1-id-2-amine;platinum(2+).
| Compound Name | acetylene;N-phenyl-9-pyridin-2-yl-N-(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)-1H-carbazol-1-id-2-amine;platinum(2+) |
|---|---|
| PubChem CID | 163770103 |
| Molecular Formula | C42H27N5Pt |
| Molecular Weight | 796.79 g/mol |
| Exact Mass | 796.19 |
| IUPAC Name | acetylene;N-phenyl-9-pyridin-2-yl-N-(9-pyridin-2-yl-1H-carbazol-1-id-2-yl)-1H-carbazol-1-id-2-amine;platinum(2+) |
| SMILES | C#C.[Pt+2].[c-]1c(N(c2[c-]c3c(cc2)c2ccccc2n3-c2ccccn2)c2ccccc2)ccc2c3ccccc3n(-c3ccccn3)c12 |
| InChI | InChI=1S/C40H25N5.C2H2.Pt/c1-2-12-28(13-3-1)43(29-20-22-33-31-14-4-6-16-35(31)44(37(33)26-29)39-18-8-10-24-41-39)30-21-23-34-32-15-5-7-17-36(32)45(38(34)27-30)40-19-9-11-25-42-40;1-2;/h1-25H;1-2H;/q-2;;+2 |
| InChIKey | PCBXBXPOPWLGQX-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.79 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|