C31H23N3OPt — CID 153433428
9-phenyl-3-pyridin-2-yloxy-6-(2-pyridin-2-ylpropan-2-yl)-4,5-dihydrocarbazole-4,5-diide;platinum(2+) (PubChem CID 153433428) has the molecular formula C31H23N3OPt and a molecular weight of 648.62 g/mol. Its IUPAC name is 9-phenyl-3-pyridin-2-yloxy-6-(2-pyridin-2-ylpropan-2-yl)-4,5-dihydrocarbazole-4,5-diide;platinum(2+).
| Compound Name | 9-phenyl-3-pyridin-2-yloxy-6-(2-pyridin-2-ylpropan-2-yl)-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
|---|---|
| PubChem CID | 153433428 |
| Molecular Formula | C31H23N3OPt |
| Molecular Weight | 648.62 g/mol |
| Exact Mass | 648.15 |
| IUPAC Name | 9-phenyl-3-pyridin-2-yloxy-6-(2-pyridin-2-ylpropan-2-yl)-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
| SMILES | CC(C)(c1[c-]c2c3[c-]c(Oc4ccccn4)ccc3n(-c3ccccc3)c2cc1)c1ccccn1.[Pt+2] |
| InChI | InChI=1S/C31H23N3O.Pt/c1-31(2,29-12-6-8-18-32-29)22-14-16-27-25(20-22)26-21-24(35-30-13-7-9-19-33-30)15-17-28(26)34(27)23-10-4-3-5-11-23;/h3-19H,1-2H3;/q-2;+2 |
| InChIKey | YDOFCQRLWQVTQO-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.62 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|