C42H45N3Pt — CID 153433417
3,6-bis[2-(4-tert-butyl-2-pyridinyl)propan-2-yl]-9-phenyl-4,5-dihydrocarbazole-4,5-diide;platinum(2+) (PubChem CID 153433417) has the molecular formula C42H45N3Pt and a molecular weight of 786.92 g/mol. Its IUPAC name is 3,6-bis[2-(4-tert-butyl-2-pyridinyl)propan-2-yl]-9-phenyl-4,5-dihydrocarbazole-4,5-diide;platinum(2+).
| Compound Name | 3,6-bis[2-(4-tert-butyl-2-pyridinyl)propan-2-yl]-9-phenyl-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
|---|---|
| PubChem CID | 153433417 |
| Molecular Formula | C42H45N3Pt |
| Molecular Weight | 786.92 g/mol |
| Exact Mass | 786.33 |
| IUPAC Name | 3,6-bis[2-(4-tert-butyl-2-pyridinyl)propan-2-yl]-9-phenyl-4,5-dihydrocarbazole-4,5-diide;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(C(C)(C)c2[c-]c3c4[c-]c(C(C)(C)c5cc(C(C)(C)C)ccn5)ccc4n(-c4ccccc4)c3cc2)c1.[Pt+2] |
| InChI | InChI=1S/C42H45N3.Pt/c1-39(2,3)28-20-22-43-37(26-28)41(7,8)30-16-18-35-33(24-30)34-25-31(17-19-36(34)45(35)32-14-12-11-13-15-32)42(9,10)38-27-29(21-23-44-38)40(4,5)6;/h11-23,26-27H,1-10H3;/q-2;+2 |
| InChIKey | IGQHRHADQXLHLB-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.92 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|