C24H19N3O2Pt — CID 58709094
phenyl-[3-[2-(3-pyridin-2-yloxybenzene-2-id-1-yl)propan-2-yl]pyrazol-1-yl]methanone;platinum(2+) (PubChem CID 58709094) has the molecular formula C24H19N3O2Pt and a molecular weight of 576.51 g/mol. Its IUPAC name is phenyl-[3-[2-(3-pyridin-2-yloxybenzene-2-id-1-yl)propan-2-yl]pyrazol-1-yl]methanone;platinum(2+).
| Compound Name | phenyl-[3-[2-(3-pyridin-2-yloxybenzene-2-id-1-yl)propan-2-yl]pyrazol-1-yl]methanone;platinum(2+) |
|---|---|
| PubChem CID | 58709094 |
| Molecular Formula | C24H19N3O2Pt |
| Molecular Weight | 576.51 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | phenyl-[3-[2-(3-pyridin-2-yloxybenzene-2-id-1-yl)propan-2-yl]pyrazol-1-yl]methanone;platinum(2+) |
| SMILES | CC(C)(c1[c-]c(Oc2ccccn2)ccc1)c1ccn(C(=O)c2[c-]cccc2)n1.[Pt+2] |
| InChI | InChI=1S/C24H19N3O2.Pt/c1-24(2,19-11-8-12-20(17-19)29-22-13-6-7-15-25-22)21-14-16-27(26-21)23(28)18-9-4-3-5-10-18;/h3-9,11-16H,1-2H3;/q-2;+2 |
| InChIKey | JEDORTJISSNSMC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|