C22H12N2O2PtS — CID 153433348
platinum(2+);2-[(8-pyridin-2-yloxy-1,9-dihydrodibenzothiophene-1,9-diid-2-yl)oxy]pyridine (PubChem CID 153433348) has the molecular formula C22H12N2O2PtS and a molecular weight of 563.50 g/mol. Its IUPAC name is platinum(2+);2-[(8-pyridin-2-yloxy-1,9-dihydrodibenzothiophene-1,9-diid-2-yl)oxy]pyridine.
| Compound Name | platinum(2+);2-[(8-pyridin-2-yloxy-1,9-dihydrodibenzothiophene-1,9-diid-2-yl)oxy]pyridine |
|---|---|
| PubChem CID | 153433348 |
| Molecular Formula | C22H12N2O2PtS |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.03 |
| IUPAC Name | platinum(2+);2-[(8-pyridin-2-yloxy-1,9-dihydrodibenzothiophene-1,9-diid-2-yl)oxy]pyridine |
| SMILES | [Pt+2].[c-]1c(Oc2ccccn2)ccc2sc3ccc(Oc4ccccn4)[c-]c3c12 |
| InChI | InChI=1S/C22H12N2O2S.Pt/c1-3-11-23-21(5-1)25-15-7-9-19-17(13-15)18-14-16(8-10-20(18)27-19)26-22-6-2-4-12-24-22;/h1-12H;/q-2;+2 |
| InChIKey | KHMLPTGMNSMPQM-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|