C40H26N5OPt- — CID 153280523
2-[4-[3-[isoquinolin-1-yl(naphthalen-1-yl)amino]benzene-2-id-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenol;platinum (PubChem CID 153280523) has the molecular formula C40H26N5OPt- and a molecular weight of 787.76 g/mol. Its IUPAC name is 2-[4-[3-[isoquinolin-1-yl(naphthalen-1-yl)amino]benzene-2-id-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenol;platinum.
| Compound Name | 2-[4-[3-[isoquinolin-1-yl(naphthalen-1-yl)amino]benzene-2-id-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenol;platinum |
|---|---|
| PubChem CID | 153280523 |
| Molecular Formula | C40H26N5OPt- |
| Molecular Weight | 787.76 g/mol |
| Exact Mass | 787.18 |
| IUPAC Name | 2-[4-[3-[isoquinolin-1-yl(naphthalen-1-yl)amino]benzene-2-id-1-yl]-6-phenyl-1,3,5-triazin-2-yl]phenol;platinum |
| SMILES | Oc1ccccc1-c1nc(-c2[c-]c(N(c3cccc4ccccc34)c3nccc4ccccc34)ccc2)nc(-c2ccccc2)n1.[Pt] |
| InChI | InChI=1S/C40H26N5O.Pt/c46-36-23-9-8-21-34(36)39-43-37(29-14-2-1-3-15-29)42-38(44-39)30-17-10-18-31(26-30)45(35-22-11-16-27-12-4-6-19-32(27)35)40-33-20-7-5-13-28(33)24-25-41-40;/h1-25,46H;/q-1; |
| InChIKey | LLVREGIZPCNFKG-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.76 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|