C30H20N4O2 — CID 153304230
2-[4-(3-isoquinolin-1-yloxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenol (PubChem CID 153304230) has the molecular formula C30H20N4O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is 2-[4-(3-isoquinolin-1-yloxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenol.
| Compound Name | 2-[4-(3-isoquinolin-1-yloxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenol |
|---|---|
| PubChem CID | 153304230 |
| Molecular Formula | C30H20N4O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[4-(3-isoquinolin-1-yloxyphenyl)-6-phenyl-1,3,5-triazin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1nc(-c2ccccc2)nc(-c2cccc(Oc3nccc4ccccc34)c2)n1 |
| InChI | InChI=1S/C30H20N4O2/c35-26-16-7-6-15-25(26)29-33-27(21-10-2-1-3-11-21)32-28(34-29)22-12-8-13-23(19-22)36-30-24-14-5-4-9-20(24)17-18-31-30/h1-19,35H |
| InChIKey | ZBCDSOYMUREPOY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |