C40H27N3Pt — CID 58871024
N,3-diphenyl-N-(3-phenyl-5-pyridin-2-ylbenzene-6-id-1-yl)-5-pyridin-2-ylbenzene-6-id-1-amine;platinum(2+) (PubChem CID 58871024) has the molecular formula C40H27N3Pt and a molecular weight of 744.76 g/mol. Its IUPAC name is N,3-diphenyl-N-(3-phenyl-5-pyridin-2-ylbenzene-6-id-1-yl)-5-pyridin-2-ylbenzene-6-id-1-amine;platinum(2+).
| Compound Name | N,3-diphenyl-N-(3-phenyl-5-pyridin-2-ylbenzene-6-id-1-yl)-5-pyridin-2-ylbenzene-6-id-1-amine;platinum(2+) |
|---|---|
| PubChem CID | 58871024 |
| Molecular Formula | C40H27N3Pt |
| Molecular Weight | 744.76 g/mol |
| Exact Mass | 744.19 |
| IUPAC Name | N,3-diphenyl-N-(3-phenyl-5-pyridin-2-ylbenzene-6-id-1-yl)-5-pyridin-2-ylbenzene-6-id-1-amine;platinum(2+) |
| SMILES | [Pt+2].[c-]1c(-c2ccccn2)cc(-c2ccccc2)cc1N(c1[c-]c(-c2ccccn2)cc(-c2ccccc2)c1)c1ccccc1 |
| InChI | InChI=1S/C40H27N3.Pt/c1-4-14-30(15-5-1)32-24-34(39-20-10-12-22-41-39)28-37(26-32)43(36-18-8-3-9-19-36)38-27-33(31-16-6-2-7-17-31)25-35(29-38)40-21-11-13-23-42-40;/h1-27H;/q-2;+2 |
| InChIKey | GBEUHDFWGOAUFS-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.76 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|