C36H25AuN3-2 — CID 140592761
4-ethynyl-N,N-diphenylaniline;gold;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine (PubChem CID 140592761) has the molecular formula C36H25AuN3-2 and a molecular weight of 696.58 g/mol. Its IUPAC name is 4-ethynyl-N,N-diphenylaniline;gold;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine.
| Compound Name | 4-ethynyl-N,N-diphenylaniline;gold;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
|---|---|
| PubChem CID | 140592761 |
| Molecular Formula | C36H25AuN3-2 |
| Molecular Weight | 696.58 g/mol |
| Exact Mass | 696.17 |
| IUPAC Name | 4-ethynyl-N,N-diphenylaniline;gold;2-(3-pyridin-2-ylbenzene-2-id-1-yl)pyridine |
| SMILES | [Au].[C-]#Cc1ccc(N(c2ccccc2)c2ccccc2)cc1.[c-]1c(-c2ccccn2)cccc1-c1ccccn1 |
| InChI | InChI=1S/C20H14N.C16H11N2.Au/c1-2-17-13-15-20(16-14-17)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19;1-3-10-17-15(8-1)13-6-5-7-14(12-13)16-9-2-4-11-18-16;/h3-16H;1-11H;/q2*-1; |
| InChIKey | DMDVJXSXUWGMHY-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.58 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|