C37H21AuF4N2 — CID 164705069
2,6-bis(2,4-difluorobenzene-6-id-1-yl)pyridine;4-ethynyl-N,N-diphenylaniline;gold(3+) (PubChem CID 164705069) has the molecular formula C37H21AuF4N2 and a molecular weight of 766.55 g/mol. Its IUPAC name is 2,6-bis(2,4-difluorobenzene-6-id-1-yl)pyridine;4-ethynyl-N,N-diphenylaniline;gold(3+).
| Compound Name | 2,6-bis(2,4-difluorobenzene-6-id-1-yl)pyridine;4-ethynyl-N,N-diphenylaniline;gold(3+) |
|---|---|
| PubChem CID | 164705069 |
| Molecular Formula | C37H21AuF4N2 |
| Molecular Weight | 766.55 g/mol |
| Exact Mass | 766.13 |
| IUPAC Name | 2,6-bis(2,4-difluorobenzene-6-id-1-yl)pyridine;4-ethynyl-N,N-diphenylaniline;gold(3+) |
| SMILES | Fc1c[c-]c(-c2cccc(-c3[c-]cc(F)cc3F)n2)c(F)c1.[Au+3].[C-]#Cc1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H14N.C17H7F4N.Au/c1-2-17-13-15-20(16-14-17)21(18-9-5-3-6-10-18)19-11-7-4-8-12-19;18-10-4-6-12(14(20)8-10)16-2-1-3-17(22-16)13-7-5-11(19)9-15(13)21;/h3-16H;1-5,8-9H;/q-1;-2;+3 |
| InChIKey | WHDOHJOQSSWDNL-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.55 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|