C14H13Cl2N3 — CID 112569415
4,6-dichloro-5-cyclopentyl-2-pyridin-2-ylpyrimidine (PubChem CID 112569415) has the molecular formula C14H13Cl2N3 and a molecular weight of 294.18 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclopentyl-2-pyridin-2-ylpyrimidine.
| Compound Name | 4,6-dichloro-5-cyclopentyl-2-pyridin-2-ylpyrimidine |
|---|---|
| PubChem CID | 112569415 |
| Molecular Formula | C14H13Cl2N3 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 4,6-dichloro-5-cyclopentyl-2-pyridin-2-ylpyrimidine |
| SMILES | Clc1nc(-c2ccccn2)nc(Cl)c1C1CCCC1 |
| InChI | InChI=1S/C14H13Cl2N3/c15-12-11(9-5-1-2-6-9)13(16)19-14(18-12)10-7-3-4-8-17-10/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | TXGGMMIQWNVVFV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |