C12H14N4 — CID 61338696
2-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 61338696) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 2-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 61338696 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(5-cyclopentyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1ccc(-c2n[nH]c(C3CCCC3)n2)nc1 |
| InChI | InChI=1S/C12H14N4/c1-2-6-9(5-1)11-14-12(16-15-11)10-7-3-4-8-13-10/h3-4,7-9H,1-2,5-6H2,(H,14,15,16) |
| InChIKey | MBWODAJDHWUOEN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |