C12H9N5 — CID 918281
3-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 918281) has the molecular formula C12H9N5 and a molecular weight of 223.24 g/mol. Its IUPAC name is 3-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine.
| Compound Name | 3-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
|---|---|
| PubChem CID | 918281 |
| Molecular Formula | C12H9N5 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 3-(5-pyridin-4-yl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | c1cncc(-c2n[nH]c(-c3ccncc3)n2)c1 |
| InChI | InChI=1S/C12H9N5/c1-2-10(8-14-5-1)12-15-11(16-17-12)9-3-6-13-7-4-9/h1-8H,(H,15,16,17) |
| InChIKey | WIHUWTSKKGOEGI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |