C15H15Cl2N3 — CID 115926418
4,6-dichloro-5-cyclopentyl-2-(4-methyl-2-pyridinyl)pyrimidine (PubChem CID 115926418) has the molecular formula C15H15Cl2N3 and a molecular weight of 308.21 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclopentyl-2-(4-methyl-2-pyridinyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-cyclopentyl-2-(4-methyl-2-pyridinyl)pyrimidine |
|---|---|
| PubChem CID | 115926418 |
| Molecular Formula | C15H15Cl2N3 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 4,6-dichloro-5-cyclopentyl-2-(4-methyl-2-pyridinyl)pyrimidine |
| SMILES | Cc1ccnc(-c2nc(Cl)c(C3CCCC3)c(Cl)n2)c1 |
| InChI | InChI=1S/C15H15Cl2N3/c1-9-6-7-18-11(8-9)15-19-13(16)12(14(17)20-15)10-4-2-3-5-10/h6-8,10H,2-5H2,1H3 |
| InChIKey | GQYANNGPHSUJNX-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |