C9H3Cl3IN3 — CID 103443010
4,6-dichloro-2-(3-chloro-2-pyridinyl)-5-iodopyrimidine (PubChem CID 103443010) has the molecular formula C9H3Cl3IN3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 4,6-dichloro-2-(3-chloro-2-pyridinyl)-5-iodopyrimidine.
| Compound Name | 4,6-dichloro-2-(3-chloro-2-pyridinyl)-5-iodopyrimidine |
|---|---|
| PubChem CID | 103443010 |
| Molecular Formula | C9H3Cl3IN3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 384.84 |
| IUPAC Name | 4,6-dichloro-2-(3-chloro-2-pyridinyl)-5-iodopyrimidine |
| SMILES | Clc1cccnc1-c1nc(Cl)c(I)c(Cl)n1 |
| InChI | InChI=1S/C9H3Cl3IN3/c10-4-2-1-3-14-6(4)9-15-7(11)5(13)8(12)16-9/h1-3H |
| InChIKey | YFEGYUQSHHIGNN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|