C10H8ClIN4 — CID 103445166
2-(3-chloro-2-pyridinyl)-5-iodo-N-methylpyrimidin-4-amine (PubChem CID 103445166) has the molecular formula C10H8ClIN4 and a molecular weight of 346.56 g/mol. Its IUPAC name is 2-(3-chloro-2-pyridinyl)-5-iodo-N-methylpyrimidin-4-amine.
| Compound Name | 2-(3-chloro-2-pyridinyl)-5-iodo-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 103445166 |
| Molecular Formula | C10H8ClIN4 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | 2-(3-chloro-2-pyridinyl)-5-iodo-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2ncccc2Cl)ncc1I |
| InChI | InChI=1S/C10H8ClIN4/c1-13-9-7(12)5-15-10(16-9)8-6(11)3-2-4-14-8/h2-5H,1H3,(H,13,15,16) |
| InChIKey | NFEYTYKHNJZCLG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|