About 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine
2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine (PubChem CID 157346640) has the molecular formula C19H18BrClF3N3
and a molecular weight of 460.73 g/mol. Its IUPAC name is 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine |
| PubChem CID | 157346640 |
| Molecular Formula | C19H18BrClF3N3 |
| Molecular Weight | 460.73 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine |
| SMILES | Cc1cccnc1Br.Cc1ncccc1C(F)(F)F.Cc1ncccc1Cl |
| InChI | InChI=1S/C7H6F3N.C6H6BrN.C6H6ClN/c1-5-6(7(8,9)10)3-2-4-11-5;1-5-3-2-4-8-6(5)7;1-5-6(7)3-2-4-8-5/h2-4H,1H3;2*2-4H,1H3 |
| InChIKey | BHAWQYCLYGTYMC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.73 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine?
The IUPAC name of 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine (CID 157346640) is 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine?
The canonical SMILES for 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine is Cc1cccnc1Br.Cc1ncccc1C(F)(F)F.Cc1ncccc1Cl.
What is the InChIKey of 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine?
The InChIKey is BHAWQYCLYGTYMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6F3N.C6H6BrN.C6H6ClN/c1-5-6(7(8,9)10)3-2-4-11-5;1-5-3-2-4-8-6(5)7;1-5-6(7)3-2-4-8-5/h2-4H,1H3;2*2-4H,1H3.
What are the key properties of 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine?
2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine has a molecular weight of 460.73 g/mol, XLogP of 6.60, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3-methylpyridine;3-chloro-2-methylpyridine;2-methyl-3-(trifluoromethyl)pyridine is sourced from PubChem (CID 157346640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).