C9H15N3O — CID 130848050
(1R,2R)-2-amino-1-(2-amino-3-pyridinyl)butan-1-ol (PubChem CID 130848050) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (1R,2R)-2-amino-1-(2-amino-3-pyridinyl)butan-1-ol.
| Compound Name | (1R,2R)-2-amino-1-(2-amino-3-pyridinyl)butan-1-ol |
|---|---|
| PubChem CID | 130848050 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (1R,2R)-2-amino-1-(2-amino-3-pyridinyl)butan-1-ol |
| SMILES | CC[C@@H](N)[C@H](O)c1cccnc1N |
| InChI | InChI=1S/C9H15N3O/c1-2-7(10)8(13)6-4-3-5-12-9(6)11/h3-5,7-8,13H,2,10H2,1H3,(H2,11,12)/t7-,8-/m1/s1 |
| InChIKey | HUXOUIOLFAARGE-HTQZYQBOSA-N |
| XLogP | 0.43 |
| TPSA | 85.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |