C13H22N2O2 — CID 116713305
1-(2-amino-3-pyridinyl)-2-ethoxy-3,3-dimethylbutan-1-ol (PubChem CID 116713305) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-2-ethoxy-3,3-dimethylbutan-1-ol.
| Compound Name | 1-(2-amino-3-pyridinyl)-2-ethoxy-3,3-dimethylbutan-1-ol |
|---|---|
| PubChem CID | 116713305 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-2-ethoxy-3,3-dimethylbutan-1-ol |
| SMILES | CCOC(C(O)c1cccnc1N)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-5-17-11(13(2,3)4)10(16)9-7-6-8-15-12(9)14/h6-8,10-11,16H,5H2,1-4H3,(H2,14,15) |
| InChIKey | VFEBKVPUODNRBV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |