C10H16ClN3 — CID 171211338
3-[(1R)-1-amino-3-methylbut-3-enyl]pyridin-2-amine;hydrochloride (PubChem CID 171211338) has the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. Its IUPAC name is 3-[(1R)-1-amino-3-methylbut-3-enyl]pyridin-2-amine;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]pyridin-2-amine;hydrochloride |
|---|---|
| PubChem CID | 171211338 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-[(1R)-1-amino-3-methylbut-3-enyl]pyridin-2-amine;hydrochloride |
| SMILES | C=C(C)C[C@@H](N)c1cccnc1N.Cl |
| InChI | InChI=1S/C10H15N3.ClH/c1-7(2)6-9(11)8-4-3-5-13-10(8)12;/h3-5,9H,1,6,11H2,2H3,(H2,12,13);1H/t9-;/m1./s1 |
| InChIKey | CAQDODDOVJHYGB-SBSPUUFOSA-N |
| XLogP | 2.05 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|