C12H22N4 — CID 79086742
1-(2-amino-3-pyridinyl)-N',N'-diethylpropane-1,3-diamine (PubChem CID 79086742) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 1-(2-amino-3-pyridinyl)-N',N'-diethylpropane-1,3-diamine.
| Compound Name | 1-(2-amino-3-pyridinyl)-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 79086742 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 1-(2-amino-3-pyridinyl)-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCC(N)c1cccnc1N |
| InChI | InChI=1S/C12H22N4/c1-3-16(4-2)9-7-11(13)10-6-5-8-15-12(10)14/h5-6,8,11H,3-4,7,9,13H2,1-2H3,(H2,14,15) |
| InChIKey | MSJNPISHQAZKMT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |