About 7-prop-1-ynylquinoline
7-prop-1-ynylquinoline (PubChem CID 91238041) has the molecular formula C12H9N
and a molecular weight of 167.21 g/mol. Its IUPAC name is 7-prop-1-ynylquinoline.
Molecular Properties
| Compound Name | 7-prop-1-ynylquinoline |
| PubChem CID | 91238041 |
| Molecular Formula | C12H9N |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 7-prop-1-ynylquinoline |
| SMILES | CC#Cc1ccc2cccnc2c1 |
| InChI | InChI=1S/C12H9N/c1-2-4-10-6-7-11-5-3-8-13-12(11)9-10/h3,5-9H,1H3 |
| InChIKey | WXNVAXPEUFPMHR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-prop-1-ynylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-prop-1-ynylquinoline?
The IUPAC name of 7-prop-1-ynylquinoline (CID 91238041) is 7-prop-1-ynylquinoline.
What is the SMILES notation for 7-prop-1-ynylquinoline?
The canonical SMILES for 7-prop-1-ynylquinoline is CC#Cc1ccc2cccnc2c1.
What is the InChIKey of 7-prop-1-ynylquinoline?
The InChIKey is WXNVAXPEUFPMHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N/c1-2-4-10-6-7-11-5-3-8-13-12(11)9-10/h3,5-9H,1H3.
What are the key properties of 7-prop-1-ynylquinoline?
7-prop-1-ynylquinoline has a molecular weight of 167.21 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-prop-1-ynylquinoline is sourced from PubChem (CID 91238041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).