C12H10N4 — CID 166607595
7-(3-methyl-1,2,4-triazol-1-yl)quinoline (PubChem CID 166607595) has the molecular formula C12H10N4 and a molecular weight of 210.24 g/mol. Its IUPAC name is 7-(3-methyl-1,2,4-triazol-1-yl)quinoline.
| Compound Name | 7-(3-methyl-1,2,4-triazol-1-yl)quinoline |
|---|---|
| PubChem CID | 166607595 |
| Molecular Formula | C12H10N4 |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 7-(3-methyl-1,2,4-triazol-1-yl)quinoline |
| SMILES | Cc1ncn(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C12H10N4/c1-9-14-8-16(15-9)11-5-4-10-3-2-6-13-12(10)7-11/h2-8H,1H3 |
| InChIKey | ZHWHUWYSVTXOAU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |