C27H24N10O — CID 169041928
1,3-bis[(5-methyl-2-quinolin-7-yl-1,2,4-triazol-3-yl)methyl]urea (PubChem CID 169041928) has the molecular formula C27H24N10O and a molecular weight of 504.56 g/mol. Its IUPAC name is 1,3-bis[(5-methyl-2-quinolin-7-yl-1,2,4-triazol-3-yl)methyl]urea.
| Compound Name | 1,3-bis[(5-methyl-2-quinolin-7-yl-1,2,4-triazol-3-yl)methyl]urea |
|---|---|
| PubChem CID | 169041928 |
| Molecular Formula | C27H24N10O |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.21 |
| IUPAC Name | 1,3-bis[(5-methyl-2-quinolin-7-yl-1,2,4-triazol-3-yl)methyl]urea |
| SMILES | Cc1nc(CNC(=O)NCc2nc(C)nn2-c2ccc3cccnc3c2)n(-c2ccc3cccnc3c2)n1 |
| InChI | InChI=1S/C27H24N10O/c1-17-32-25(36(34-17)21-9-7-19-5-3-11-28-23(19)13-21)15-30-27(38)31-16-26-33-18(2)35-37(26)22-10-8-20-6-4-12-29-24(20)14-22/h3-14H,15-16H2,1-2H3,(H2,30,31,38) |
| InChIKey | UOBGDSXVQRDFKH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 128.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |