About (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium
(7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium (PubChem CID 169041883) has the molecular formula C15H15N4O+
and a molecular weight of 267.31 g/mol. Its IUPAC name is (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium.
Molecular Properties
| Compound Name | (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium |
| PubChem CID | 169041883 |
| Molecular Formula | C15H15N4O+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium |
| SMILES | [NH3+]CC1=NC2(CC2)C(=O)N1c1ccc2cccnc2c1 |
| InChI | InChI=1S/C15H14N4O/c16-9-13-18-15(5-6-15)14(20)19(13)11-4-3-10-2-1-7-17-12(10)8-11/h1-4,7-8H,5-6,9,16H2/p+1 |
| InChIKey | VNQJJPPOUAXFGE-UHFFFAOYSA-O |
| XLogP | 0.75 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium?
The IUPAC name of (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium (CID 169041883) is (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium.
What is the SMILES notation for (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium?
The canonical SMILES for (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium is [NH3+]CC1=NC2(CC2)C(=O)N1c1ccc2cccnc2c1.
What is the InChIKey of (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium?
The InChIKey is VNQJJPPOUAXFGE-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H14N4O/c16-9-13-18-15(5-6-15)14(20)19(13)11-4-3-10-2-1-7-17-12(10)8-11/h1-4,7-8H,5-6,9,16H2/p+1.
What are the key properties of (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium?
(7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium has a molecular weight of 267.31 g/mol, XLogP of 0.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7-oxo-6-quinolin-7-yl-4,6-diazaspiro[2.4]hept-4-en-5-yl)methylazanium is sourced from PubChem (CID 169041883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).