C24H24N2O — CID 25022613
4-(4-tert-butylphenyl)-1-quinolin-7-yl-2,3-dihydropyridin-6-one (PubChem CID 25022613) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-1-quinolin-7-yl-2,3-dihydropyridin-6-one.
| Compound Name | 4-(4-tert-butylphenyl)-1-quinolin-7-yl-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 25022613 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 4-(4-tert-butylphenyl)-1-quinolin-7-yl-2,3-dihydropyridin-6-one |
| SMILES | CC(C)(C)c1ccc(C2=CC(=O)N(c3ccc4cccnc4c3)CC2)cc1 |
| InChI | InChI=1S/C24H24N2O/c1-24(2,3)20-9-6-17(7-10-20)19-12-14-26(23(27)15-19)21-11-8-18-5-4-13-25-22(18)16-21/h4-11,13,15-16H,12,14H2,1-3H3 |
| InChIKey | OOAJRXIJQAVJTJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |