C17H21N3O — CID 69259812
1-cyclohexyl-1-methyl-3-quinolin-7-ylurea (PubChem CID 69259812) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 1-cyclohexyl-1-methyl-3-quinolin-7-ylurea.
| Compound Name | 1-cyclohexyl-1-methyl-3-quinolin-7-ylurea |
|---|---|
| PubChem CID | 69259812 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-cyclohexyl-1-methyl-3-quinolin-7-ylurea |
| SMILES | CN(C(=O)Nc1ccc2cccnc2c1)C1CCCCC1 |
| InChI | InChI=1S/C17H21N3O/c1-20(15-7-3-2-4-8-15)17(21)19-14-10-9-13-6-5-11-18-16(13)12-14/h5-6,9-12,15H,2-4,7-8H2,1H3,(H,19,21) |
| InChIKey | OFKGGQLQAWSFJV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |